C22H24N6OS — CID 24563785
4-propyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 24563785) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is 4-propyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-propyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 24563785 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-propyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCn1c(=O)c2ccccc2n2c(=S)n(CN3CCCC3c3cccnc3)nc12 |
| InChI | InChI=1S/C22H24N6OS/c1-2-12-26-20(29)17-8-3-4-9-19(17)28-21(26)24-27(22(28)30)15-25-13-6-10-18(25)16-7-5-11-23-14-16/h3-5,7-9,11,14,18H,2,6,10,12-13,15H2,1H3 |
| InChIKey | QNIKCQSXWWSSNU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|