C20H27N5OS — CID 42886027
4-butyl-2-[(4-methylpiperidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 42886027) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is 4-butyl-2-[(4-methylpiperidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-butyl-2-[(4-methylpiperidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 42886027 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-butyl-2-[(4-methylpiperidin-1-yl)methyl]-1-sulfanylidene-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCCn1c(=O)c2ccccc2n2c(=S)n(CN3CCC(C)CC3)nc12 |
| InChI | InChI=1S/C20H27N5OS/c1-3-4-11-23-18(26)16-7-5-6-8-17(16)25-19(23)21-24(20(25)27)14-22-12-9-15(2)10-13-22/h5-8,15H,3-4,9-14H2,1-2H3 |
| InChIKey | UVHWJDRBVQXUIP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|