C16H23N5S2 — CID 24563808
5-(tert-butylamino)-3-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 24563808) has the molecular formula C16H23N5S2 and a molecular weight of 349.53 g/mol. Its IUPAC name is 5-(tert-butylamino)-3-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(tert-butylamino)-3-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 24563808 |
| Molecular Formula | C16H23N5S2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 5-(tert-butylamino)-3-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CC(C)(C)Nc1nn(CN2CCCC2c2cccnc2)c(=S)s1 |
| InChI | InChI=1S/C16H23N5S2/c1-16(2,3)18-14-19-21(15(22)23-14)11-20-9-5-7-13(20)12-6-4-8-17-10-12/h4,6,8,10,13H,5,7,9,11H2,1-3H3,(H,18,19) |
| InChIKey | XUXUHEHVDHUDGX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|