C19H28N4OS2 — CID 24563571
5-(tert-butylamino)-3-[[2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 24563571) has the molecular formula C19H28N4OS2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 5-(tert-butylamino)-3-[[2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(tert-butylamino)-3-[[2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 24563571 |
| Molecular Formula | C19H28N4OS2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 5-(tert-butylamino)-3-[[2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CCOc1ccc(C2CCCN2Cn2nc(NC(C)(C)C)sc2=S)cc1 |
| InChI | InChI=1S/C19H28N4OS2/c1-5-24-15-10-8-14(9-11-15)16-7-6-12-22(16)13-23-18(25)26-17(21-23)20-19(2,3)4/h8-11,16H,5-7,12-13H2,1-4H3,(H,20,21) |
| InChIKey | LHNGYRJHAZEVIA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|