C23H28N4OS — CID 9324696
4-benzyl-2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione (PubChem CID 9324696) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-benzyl-2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9324696 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-benzyl-2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione |
| SMILES | CCOc1ccc([C@@H]2CCCN2Cn2nc(C)n(Cc3ccccc3)c2=S)cc1 |
| InChI | InChI=1S/C23H28N4OS/c1-3-28-21-13-11-20(12-14-21)22-10-7-15-25(22)17-27-23(29)26(18(2)24-27)16-19-8-5-4-6-9-19/h4-6,8-9,11-14,22H,3,7,10,15-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | XFIYJBJECZEFAX-QFIPXVFZSA-N |
| XLogP | 4.96 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|