C22H26N4OS — CID 25410726
2-[[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-4-(4-methylphenyl)-1,2,4-triazole-3-thione (PubChem CID 25410726) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-4-(4-methylphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-4-(4-methylphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 25410726 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methyl]-5-methyl-4-(4-methylphenyl)-1,2,4-triazole-3-thione |
| SMILES | COc1ccc([C@H]2CCCN2Cn2nc(C)n(-c3ccc(C)cc3)c2=S)cc1 |
| InChI | InChI=1S/C22H26N4OS/c1-16-6-10-19(11-7-16)26-17(2)23-25(22(26)28)15-24-14-4-5-21(24)18-8-12-20(27-3)13-9-18/h6-13,21H,4-5,14-15H2,1-3H3/t21-/m1/s1 |
| InChIKey | SHUKZKXWCQEYGW-OAQYLSRUSA-N |
| XLogP | 4.82 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|