C23H28N4O2S — CID 17464330
2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-methyl-5-(3-methylphenyl)-1,2,4-triazole-3-thione (PubChem CID 17464330) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-methyl-5-(3-methylphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-methyl-5-(3-methylphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17464330 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-4-methyl-5-(3-methylphenyl)-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(OC)c(C2CCCN2Cn2nc(-c3cccc(C)c3)n(C)c2=S)c1 |
| InChI | InChI=1S/C23H28N4O2S/c1-16-7-5-8-17(13-16)22-24-27(23(30)25(22)2)15-26-12-6-9-20(26)19-14-18(28-3)10-11-21(19)29-4/h5,7-8,10-11,13-14,20H,6,9,12,15H2,1-4H3 |
| InChIKey | SBODZJISCUCEIZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|