C23H27N3O4S — CID 24505359
3-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 24505359) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 24505359 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(Cc2nn(CN3CCCC3c3ccc(OC)cc3OC)c(=S)o2)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-27-17-8-6-16(7-9-17)13-22-24-26(23(31)30-22)15-25-12-4-5-20(25)19-11-10-18(28-2)14-21(19)29-3/h6-11,14,20H,4-5,12-13,15H2,1-3H3 |
| InChIKey | DCXQIQVIHGXVIX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|