C21H23N3O4 — CID 25360535
4-amino-2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 25360535) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-amino-2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 25360535 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-amino-2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(OC)c([C@H]2CCCN2CN2C(=O)c3cccc(N)c3C2=O)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-27-13-8-9-18(28-2)15(11-13)17-7-4-10-23(17)12-24-20(25)14-5-3-6-16(22)19(14)21(24)26/h3,5-6,8-9,11,17H,4,7,10,12,22H2,1-2H3/t17-/m1/s1 |
| InChIKey | FTHOJTMONWEHHM-QGZVFWFLSA-N |
| XLogP | 2.68 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|