C29H31N3O4 — CID 26008911
(5S)-5-benzyl-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 26008911) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26008911 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (5S)-5-benzyl-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2CN2C(=O)N[C@@](Cc3ccccc3)(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C29H31N3O4/c1-35-23-15-16-26(36-2)24(18-23)25-14-9-17-31(25)20-32-27(33)29(30-28(32)34,22-12-7-4-8-13-22)19-21-10-5-3-6-11-21/h3-8,10-13,15-16,18,25H,9,14,17,19-20H2,1-2H3,(H,30,34)/t25-,29-/m0/s1 |
| InChIKey | ORCRCVHTOMUVRA-SVEHJYQDSA-N |
| XLogP | 4.49 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|