C18H20F3N3O5 — CID 9285424
1-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione (PubChem CID 9285424) has the molecular formula C18H20F3N3O5 and a molecular weight of 415.37 g/mol. Its IUPAC name is 1-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9285424 |
| Molecular Formula | C18H20F3N3O5 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2CN2C(=O)C(=O)N(CC(F)(F)F)C2=O)c1 |
| InChI | InChI=1S/C18H20F3N3O5/c1-28-11-5-6-14(29-2)12(8-11)13-4-3-7-22(13)10-24-16(26)15(25)23(17(24)27)9-18(19,20)21/h5-6,8,13H,3-4,7,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | TUGPWTPKUROPOX-ZDUSSCGKSA-N |
| XLogP | 2.15 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|