C18H24N4O2S2 — CID 9285392
3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(prop-2-enylamino)-1,3,4-thiadiazole-2-thione (PubChem CID 9285392) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(prop-2-enylamino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(prop-2-enylamino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9285392 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(prop-2-enylamino)-1,3,4-thiadiazole-2-thione |
| SMILES | C=CCNc1nn(CN2CCC[C@H]2c2cc(OC)ccc2OC)c(=S)s1 |
| InChI | InChI=1S/C18H24N4O2S2/c1-4-9-19-17-20-22(18(25)26-17)12-21-10-5-6-15(21)14-11-13(23-2)7-8-16(14)24-3/h4,7-8,11,15H,1,5-6,9-10,12H2,2-3H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | ZAWLZSZZDPATLO-HNNXBMFYSA-N |
| XLogP | 4.08 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|