C27H36N6OS — CID 41114999
2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-4-[(1S,2S)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 41114999) has the molecular formula C27H36N6OS and a molecular weight of 492.69 g/mol. Its IUPAC name is 2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-4-[(1S,2S)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-4-[(1S,2S)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 41114999 |
| Molecular Formula | C27H36N6OS |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-4-[(1S,2S)-2-methylcyclohexyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | CCOc1ccccc1N1CCN(Cn2nc(-c3cccnc3)n([C@H]3CCCC[C@@H]3C)c2=S)CC1 |
| InChI | InChI=1S/C27H36N6OS/c1-3-34-25-13-7-6-12-24(25)31-17-15-30(16-18-31)20-32-27(35)33(23-11-5-4-9-21(23)2)26(29-32)22-10-8-14-28-19-22/h6-8,10,12-14,19,21,23H,3-5,9,11,15-18,20H2,1-2H3/t21-,23-/m0/s1 |
| InChIKey | MLIPDVPDLXZUHZ-GMAHTHKFSA-N |
| XLogP | 5.41 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|