C22H17Cl2N3OS — CID 55822610
[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloroquinolin-6-yl)methanone (PubChem CID 55822610) has the molecular formula C22H17Cl2N3OS and a molecular weight of 442.37 g/mol. Its IUPAC name is [4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloroquinolin-6-yl)methanone.
| Compound Name | [4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloroquinolin-6-yl)methanone |
|---|---|
| PubChem CID | 55822610 |
| Molecular Formula | C22H17Cl2N3OS |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | [4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-chloroquinolin-6-yl)methanone |
| SMILES | O=C(c1ccc2nc(Cl)ccc2c1)N1CCC(c2nc3cc(Cl)ccc3s2)CC1 |
| InChI | InChI=1S/C22H17Cl2N3OS/c23-16-3-5-19-18(12-16)26-21(29-19)13-7-9-27(10-8-13)22(28)15-1-4-17-14(11-15)2-6-20(24)25-17/h1-6,11-13H,7-10H2 |
| InChIKey | FTZHJKIDZBAEAO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|