C23H32BN3O4 — CID 174029050
(5S)-5-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]piperidin-1-yl]methyl]pyrrolidin-2-one (PubChem CID 174029050) has the molecular formula C23H32BN3O4 and a molecular weight of 425.34 g/mol. Its IUPAC name is (5S)-5-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]piperidin-1-yl]methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]piperidin-1-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 174029050 |
| Molecular Formula | C23H32BN3O4 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (5S)-5-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]piperidin-1-yl]methyl]pyrrolidin-2-one |
| SMILES | CC1(C)OB(c2ccc3oc(C4CCN(C[C@@H]5CCC(=O)N5)CC4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C23H32BN3O4/c1-22(2)23(3,4)31-24(30-22)16-5-7-19-18(13-16)26-21(29-19)15-9-11-27(12-10-15)14-17-6-8-20(28)25-17/h5,7,13,15,17H,6,8-12,14H2,1-4H3,(H,25,28)/t17-/m0/s1 |
| InChIKey | SDCNDJVPNNDTBY-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|