C15H17FN2O3 — CID 82167824
3-[4-(5-fluoro-1,3-benzoxazol-2-yl)piperidin-1-yl]propanoic acid (PubChem CID 82167824) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-[4-(5-fluoro-1,3-benzoxazol-2-yl)piperidin-1-yl]propanoic acid.
| Compound Name | 3-[4-(5-fluoro-1,3-benzoxazol-2-yl)piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 82167824 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[4-(5-fluoro-1,3-benzoxazol-2-yl)piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCC(c2nc3cc(F)ccc3o2)CC1 |
| InChI | InChI=1S/C15H17FN2O3/c16-11-1-2-13-12(9-11)17-15(21-13)10-3-6-18(7-4-10)8-5-14(19)20/h1-2,9-10H,3-8H2,(H,19,20) |
| InChIKey | YLJXFCXGJNTVQB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |