C31H27BN2O3 — CID 147786465
2-(3-carbazol-9-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (PubChem CID 147786465) has the molecular formula C31H27BN2O3 and a molecular weight of 486.38 g/mol. Its IUPAC name is 2-(3-carbazol-9-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(3-carbazol-9-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 147786465 |
| Molecular Formula | C31H27BN2O3 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-(3-carbazol-9-ylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| SMILES | CC1(C)OB(c2ccc3oc(-c4cccc(-n5c6ccccc6c6ccccc65)c4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C31H27BN2O3/c1-30(2)31(3,4)37-32(36-30)21-16-17-28-25(19-21)33-29(35-28)20-10-9-11-22(18-20)34-26-14-7-5-12-23(26)24-13-6-8-15-27(24)34/h5-19H,1-4H3 |
| InChIKey | HIUAKXLIVJXJHC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|