C41H33BN2O3 — CID 176647105
5-phenyl-14-(3-phenylphenyl)-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-oxa-6,14-diazapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15(20),16,18-nonaene (PubChem CID 176647105) has the molecular formula C41H33BN2O3 and a molecular weight of 612.54 g/mol. Its IUPAC name is 5-phenyl-14-(3-phenylphenyl)-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-oxa-6,14-diazapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15(20),16,18-nonaene.
| Compound Name | 5-phenyl-14-(3-phenylphenyl)-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-oxa-6,14-diazapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 176647105 |
| Molecular Formula | C41H33BN2O3 |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 5-phenyl-14-(3-phenylphenyl)-17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-oxa-6,14-diazapentacyclo[11.7.0.02,10.03,7.015,20]icosa-1(13),2(10),3(7),5,8,11,15(20),16,18-nonaene |
| SMILES | CC1(C)OB(c2ccc3c4c5c(ccc6nc(-c7ccccc7)oc65)ccc4n(-c4cccc(-c5ccccc5)c4)c3c2)OC1(C)C |
| InChI | InChI=1S/C41H33BN2O3/c1-40(2)41(3,4)47-42(46-40)30-20-21-32-35(25-30)44(31-17-11-16-29(24-31)26-12-7-5-8-13-26)34-23-19-27-18-22-33-38(36(27)37(32)34)45-39(43-33)28-14-9-6-10-15-28/h5-25H,1-4H3 |
| InChIKey | JSMRTVKSZVROGF-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|