C37H31BN2O3 — CID 144788220
2,9-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]carbazole (PubChem CID 144788220) has the molecular formula C37H31BN2O3 and a molecular weight of 562.48 g/mol. Its IUPAC name is 2,9-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]carbazole.
| Compound Name | 2,9-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]carbazole |
|---|---|
| PubChem CID | 144788220 |
| Molecular Formula | C37H31BN2O3 |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 2,9-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]carbazole |
| SMILES | CC1(C)OB(c2cccc(-c3ccc4c(c3)c3cc5oc(-c6ccccc6)nc5cc3n4-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C37H31BN2O3/c1-36(2)37(3,4)43-38(42-36)27-15-11-14-25(20-27)26-18-19-32-29(21-26)30-22-34-31(39-35(41-34)24-12-7-5-8-13-24)23-33(30)40(32)28-16-9-6-10-17-28/h5-23H,1-4H3 |
| InChIKey | SDXJVPOXEQDSJP-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 49.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|