C31H29BN2O2 — CID 154596663
1,5-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole (PubChem CID 154596663) has the molecular formula C31H29BN2O2 and a molecular weight of 472.40 g/mol. Its IUPAC name is 1,5-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole.
| Compound Name | 1,5-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole |
|---|---|
| PubChem CID | 154596663 |
| Molecular Formula | C31H29BN2O2 |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 1,5-diphenyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole |
| SMILES | CC1(C)OB(c2cccc(-c3nn(-c4ccccc4)c4ccc(-c5ccccc5)cc34)c2)OC1(C)C |
| InChI | InChI=1S/C31H29BN2O2/c1-30(2)31(3,4)36-32(35-30)25-15-11-14-24(20-25)29-27-21-23(22-12-7-5-8-13-22)18-19-28(27)34(33-29)26-16-9-6-10-17-26/h5-21H,1-4H3 |
| InChIKey | ZAYOGADMXAYUEH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|