C23H26BN5O2 — CID 142399028
2-(4-pyrazin-2-ylpyrimidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 142399028) has the molecular formula C23H26BN5O2 and a molecular weight of 415.31 g/mol. Its IUPAC name is 2-(4-pyrazin-2-ylpyrimidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(4-pyrazin-2-ylpyrimidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 142399028 |
| Molecular Formula | C23H26BN5O2 |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 2-(4-pyrazin-2-ylpyrimidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCN(c2nccc(-c4cnccn4)n2)C3)OC1(C)C |
| InChI | InChI=1S/C23H26BN5O2/c1-22(2)23(3,4)31-24(30-22)18-6-5-17-15-29(12-8-16(17)13-18)21-27-9-7-19(28-21)20-14-25-10-11-26-20/h5-7,9-11,13-14H,8,12,15H2,1-4H3 |
| InChIKey | JIDDFCXCHXIMPC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|