C22H34BNO4 — CID 67066427
tert-butyl-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroinden-1-yl]methyl]carbamic acid (PubChem CID 67066427) has the molecular formula C22H34BNO4 and a molecular weight of 387.33 g/mol. Its IUPAC name is tert-butyl-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroinden-1-yl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroinden-1-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 67066427 |
| Molecular Formula | C22H34BNO4 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | tert-butyl-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroinden-1-yl]methyl]carbamic acid |
| SMILES | CC1(CN(C(=O)O)C(C)(C)C)CCc2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C22H34BNO4/c1-19(2,3)24(18(25)26)14-22(8)12-11-15-13-16(9-10-17(15)22)23-27-20(4,5)21(6,7)28-23/h9-10,13H,11-12,14H2,1-8H3,(H,25,26) |
| InChIKey | PFQHVCMGJOPGQH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|