C16H26N2O5 — CID 118692225
tert-butyl-[[5-[[tert-butyl(carboxy)amino]methyl]furan-2-yl]methyl]carbamic acid (PubChem CID 118692225) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is tert-butyl-[[5-[[tert-butyl(carboxy)amino]methyl]furan-2-yl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[5-[[tert-butyl(carboxy)amino]methyl]furan-2-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 118692225 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl-[[5-[[tert-butyl(carboxy)amino]methyl]furan-2-yl]methyl]carbamic acid |
| SMILES | CC(C)(C)N(Cc1ccc(CN(C(=O)O)C(C)(C)C)o1)C(=O)O |
| InChI | InChI=1S/C16H26N2O5/c1-15(2,3)17(13(19)20)9-11-7-8-12(23-11)10-18(14(21)22)16(4,5)6/h7-8H,9-10H2,1-6H3,(H,19,20)(H,21,22) |
| InChIKey | UBLBOMNAFCAAEC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |