C18H21FN2O3 — CID 89400997
[2-amino-5-(4-fluorophenoxy)phenyl]methyl-tert-butylcarbamic acid (PubChem CID 89400997) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is [2-amino-5-(4-fluorophenoxy)phenyl]methyl-tert-butylcarbamic acid.
| Compound Name | [2-amino-5-(4-fluorophenoxy)phenyl]methyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 89400997 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [2-amino-5-(4-fluorophenoxy)phenyl]methyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(Cc1cc(Oc2ccc(F)cc2)ccc1N)C(=O)O |
| InChI | InChI=1S/C18H21FN2O3/c1-18(2,3)21(17(22)23)11-12-10-15(8-9-16(12)20)24-14-6-4-13(19)5-7-14/h4-10H,11,20H2,1-3H3,(H,22,23) |
| InChIKey | YFYILWKFVDCVED-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|