C36H32F2N2O8 — CID 18663920
(1R,2R,3R,4R)-3,4-bis[[4-(4-fluorophenoxy)phenyl]methyl-methylcarbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 18663920) has the molecular formula C36H32F2N2O8 and a molecular weight of 658.65 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3,4-bis[[4-(4-fluorophenoxy)phenyl]methyl-methylcarbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3,4-bis[[4-(4-fluorophenoxy)phenyl]methyl-methylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 18663920 |
| Molecular Formula | C36H32F2N2O8 |
| Molecular Weight | 658.65 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | (1R,2R,3R,4R)-3,4-bis[[4-(4-fluorophenoxy)phenyl]methyl-methylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | CN(Cc1ccc(Oc2ccc(F)cc2)cc1)C(=O)[C@H]1[C@@H](C(=O)O)[C@H](C(=O)O)[C@@H]1C(=O)N(C)Cc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C36H32F2N2O8/c1-39(19-21-3-11-25(12-4-21)47-27-15-7-23(37)8-16-27)33(41)29-30(32(36(45)46)31(29)35(43)44)34(42)40(2)20-22-5-13-26(14-6-22)48-28-17-9-24(38)10-18-28/h3-18,29-32H,19-20H2,1-2H3,(H,43,44)(H,45,46)/t29-,30-,31-,32-/m1/s1 |
| InChIKey | LINWAMBVGYHTFJ-SEVDZJIVSA-N |
| XLogP | 5.81 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |