C42H46N2O8 — CID 67770557
3,4-bis[[(2S)-butan-2-yl]-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 67770557) has the molecular formula C42H46N2O8 and a molecular weight of 706.84 g/mol. Its IUPAC name is 3,4-bis[[(2S)-butan-2-yl]-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | 3,4-bis[[(2S)-butan-2-yl]-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67770557 |
| Molecular Formula | C42H46N2O8 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | 3,4-bis[[(2S)-butan-2-yl]-[(4-phenoxyphenyl)methyl]carbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | CC[C@H](C)N(Cc1ccc(Oc2ccccc2)cc1)C(=O)C1C(C(=O)O)C(C(=O)O)C1C(=O)N(Cc1ccc(Oc2ccccc2)cc1)[C@@H](C)CC |
| InChI | InChI=1S/C42H46N2O8/c1-5-27(3)43(25-29-17-21-33(22-18-29)51-31-13-9-7-10-14-31)39(45)35-36(38(42(49)50)37(35)41(47)48)40(46)44(28(4)6-2)26-30-19-23-34(24-20-30)52-32-15-11-8-12-16-32/h7-24,27-28,35-38H,5-6,25-26H2,1-4H3,(H,47,48)(H,49,50)/t27-,28-,35?,36?,37?,38?/m0/s1 |
| InChIKey | BWVCEJQVBQQFPC-FZLBDIKKSA-N |
| XLogP | 7.87 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |