C13H19FN2O2 — CID 68602940
[(2R)-2-amino-2-(4-fluorophenyl)ethyl]-tert-butylcarbamic acid (PubChem CID 68602940) has the molecular formula C13H19FN2O2 and a molecular weight of 254.31 g/mol. Its IUPAC name is [(2R)-2-amino-2-(4-fluorophenyl)ethyl]-tert-butylcarbamic acid.
| Compound Name | [(2R)-2-amino-2-(4-fluorophenyl)ethyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 68602940 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | [(2R)-2-amino-2-(4-fluorophenyl)ethyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C[C@H](N)c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C13H19FN2O2/c1-13(2,3)16(12(17)18)8-11(15)9-4-6-10(14)7-5-9/h4-7,11H,8,15H2,1-3H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | DALMHTOMYZFRBO-NSHDSACASA-N |
| XLogP | 2.60 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |