C21H21FN2O4 — CID 90232341
tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)ethyl]carbamic acid (PubChem CID 90232341) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 90232341 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-2-(4-fluorophenyl)ethyl]carbamic acid |
| SMILES | CC(C)(C)N(CC(c1ccc(F)cc1)N1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C21H21FN2O4/c1-21(2,3)23(20(27)28)12-17(13-8-10-14(22)11-9-13)24-18(25)15-6-4-5-7-16(15)19(24)26/h4-11,17H,12H2,1-3H3,(H,27,28) |
| InChIKey | LCTZHSNUYFEEJE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|