C22H23FN2O5 — CID 90232328
tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenoxy)propyl]carbamic acid (PubChem CID 90232328) has the molecular formula C22H23FN2O5 and a molecular weight of 414.43 g/mol. Its IUPAC name is tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenoxy)propyl]carbamic acid.
| Compound Name | tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenoxy)propyl]carbamic acid |
|---|---|
| PubChem CID | 90232328 |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | tert-butyl-[2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenoxy)propyl]carbamic acid |
| SMILES | CC(C)(C)N(CC(COc1ccc(F)cc1)N1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C22H23FN2O5/c1-22(2,3)24(21(28)29)12-15(13-30-16-10-8-14(23)9-11-16)25-19(26)17-6-4-5-7-18(17)20(25)27/h4-11,15H,12-13H2,1-3H3,(H,28,29) |
| InChIKey | DVFZKSAVRVDCSV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|