C17H12N2O3 — CID 934406
2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]benzonitrile (PubChem CID 934406) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]benzonitrile.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 934406 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H12N2O3/c18-11-12-5-1-4-8-15(12)22-10-9-19-16(20)13-6-2-3-7-14(13)17(19)21/h1-8H,9-10H2 |
| InChIKey | WBZXUIUTQRACSG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|