About (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate
(4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2937346) has the molecular formula C18H15NO5
and a molecular weight of 325.32 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate |
| PubChem CID | 2937346 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1ccc(OC(=O)C(C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H15NO5/c1-11(18(22)24-13-9-7-12(23-2)8-10-13)19-16(20)14-5-3-4-6-15(14)17(19)21/h3-11H,1-2H3 |
| InChIKey | BCGUBOAICOBJJO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate?
The IUPAC name of (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate (CID 2937346) is (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate.
What is the SMILES notation for (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate?
The canonical SMILES for (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate is COc1ccc(OC(=O)C(C)N2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate?
The InChIKey is BCGUBOAICOBJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5/c1-11(18(22)24-13-9-7-12(23-2)8-10-13)19-16(20)14-5-3-4-6-15(14)17(19)21/h3-11H,1-2H3.
What are the key properties of (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate?
(4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate has a molecular weight of 325.32 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate is sourced from PubChem (CID 2937346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).