C18H13NO6 — CID 728514
methyl 4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxybenzoate (PubChem CID 728514) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is methyl 4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxybenzoate.
| Compound Name | methyl 4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 728514 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | methyl 4-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxybenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H13NO6/c1-24-18(23)11-6-8-12(9-7-11)25-15(20)10-19-16(21)13-4-2-3-5-14(13)17(19)22/h2-9H,10H2,1H3 |
| InChIKey | RBCBGASUKQTMAS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|