C21H21NO7S — CID 3841326
(4-ethoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate (PubChem CID 3841326) has the molecular formula C21H21NO7S and a molecular weight of 431.47 g/mol. Its IUPAC name is (4-ethoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate.
| Compound Name | (4-ethoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 3841326 |
| Molecular Formula | C21H21NO7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (4-ethoxyphenyl) 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoate |
| SMILES | CCOc1ccc(OC(=O)C(CCS(C)(=O)=O)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H21NO7S/c1-3-28-14-8-10-15(11-9-14)29-21(25)18(12-13-30(2,26)27)22-19(23)16-6-4-5-7-17(16)20(22)24/h4-11,18H,3,12-13H2,1-2H3 |
| InChIKey | YUEOONHLUJHTHY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|