C16H18F2N2O3 — CID 158720489
2-amino-2-(4-fluorophenyl)acetic acid;2-amino-2-(4-fluorophenyl)ethanol (PubChem CID 158720489) has the molecular formula C16H18F2N2O3 and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-amino-2-(4-fluorophenyl)acetic acid;2-amino-2-(4-fluorophenyl)ethanol.
| Compound Name | 2-amino-2-(4-fluorophenyl)acetic acid;2-amino-2-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 158720489 |
| Molecular Formula | C16H18F2N2O3 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-amino-2-(4-fluorophenyl)acetic acid;2-amino-2-(4-fluorophenyl)ethanol |
| SMILES | NC(C(=O)O)c1ccc(F)cc1.NC(CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H8FNO2.C8H10FNO/c9-6-3-1-5(2-4-6)7(10)8(11)12;9-7-3-1-6(2-4-7)8(10)5-11/h1-4,7H,10H2,(H,11,12);1-4,8,11H,5,10H2 |
| InChIKey | IJVVZOUVNBZPKB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |