C19H22FNO4 — CID 67722892
2-(1-aminoethyl)-5-[4-(4-fluorophenoxy)phenoxy]pentanoic acid (PubChem CID 67722892) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-[4-(4-fluorophenoxy)phenoxy]pentanoic acid.
| Compound Name | 2-(1-aminoethyl)-5-[4-(4-fluorophenoxy)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 67722892 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(1-aminoethyl)-5-[4-(4-fluorophenoxy)phenoxy]pentanoic acid |
| SMILES | CC(N)C(CCCOc1ccc(Oc2ccc(F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H22FNO4/c1-13(21)18(19(22)23)3-2-12-24-15-8-10-17(11-9-15)25-16-6-4-14(20)5-7-16/h4-11,13,18H,2-3,12,21H2,1H3,(H,22,23) |
| InChIKey | DAODAKOCXJAFFY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|