C15H22FNO3 — CID 53240991
(3S,5S)-3-(aminomethyl)-7-(4-fluorophenoxy)-5-methylheptanoic acid (PubChem CID 53240991) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is (3S,5S)-3-(aminomethyl)-7-(4-fluorophenoxy)-5-methylheptanoic acid.
| Compound Name | (3S,5S)-3-(aminomethyl)-7-(4-fluorophenoxy)-5-methylheptanoic acid |
|---|---|
| PubChem CID | 53240991 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3S,5S)-3-(aminomethyl)-7-(4-fluorophenoxy)-5-methylheptanoic acid |
| SMILES | C[C@H](CCOc1ccc(F)cc1)C[C@H](CN)CC(=O)O |
| InChI | InChI=1S/C15H22FNO3/c1-11(8-12(10-17)9-15(18)19)6-7-20-14-4-2-13(16)3-5-14/h2-5,11-12H,6-10,17H2,1H3,(H,18,19)/t11-,12+/m1/s1 |
| InChIKey | YJDWLYFZXSNACU-NEPJUHHUSA-N |
| XLogP | 2.67 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |