C15H22ClNO3 — CID 57244851
(3S)-3-(aminomethyl)-7-(4-chlorophenoxy)-5-methylheptanoic acid (PubChem CID 57244851) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-7-(4-chlorophenoxy)-5-methylheptanoic acid.
| Compound Name | (3S)-3-(aminomethyl)-7-(4-chlorophenoxy)-5-methylheptanoic acid |
|---|---|
| PubChem CID | 57244851 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3S)-3-(aminomethyl)-7-(4-chlorophenoxy)-5-methylheptanoic acid |
| SMILES | CC(CCOc1ccc(Cl)cc1)C[C@H](CN)CC(=O)O |
| InChI | InChI=1S/C15H22ClNO3/c1-11(8-12(10-17)9-15(18)19)6-7-20-14-4-2-13(16)3-5-14/h2-5,11-12H,6-10,17H2,1H3,(H,18,19)/t11?,12-/m0/s1 |
| InChIKey | ILGDLVFKEURNOD-KIYNQFGBSA-N |
| XLogP | 3.18 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |