C22H34BNO5 — CID 67260926
tert-butyl-[3-hydroxy-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]carbamic acid (PubChem CID 67260926) has the molecular formula C22H34BNO5 and a molecular weight of 403.33 g/mol. Its IUPAC name is tert-butyl-[3-hydroxy-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]carbamic acid.
| Compound Name | tert-butyl-[3-hydroxy-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 67260926 |
| Molecular Formula | C22H34BNO5 |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl-[3-hydroxy-3-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]carbamic acid |
| SMILES | CC1(O)CC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)(N(C(=O)O)C(C)(C)C)C1 |
| InChI | InChI=1S/C22H34BNO5/c1-18(2,3)24(17(25)26)22(13-21(8,27)14-22)15-9-11-16(12-10-15)23-28-19(4,5)20(6,7)29-23/h9-12,27H,13-14H2,1-8H3,(H,25,26) |
| InChIKey | OWGVZOKUICMLDD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|