C22H24BCl2NO4 — CID 66789021
4-(3,4-dichlorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 66789021) has the molecular formula C22H24BCl2NO4 and a molecular weight of 448.16 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 4-(3,4-dichlorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 66789021 |
| Molecular Formula | C22H24BCl2NO4 |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc3c(c2)CN(C(=O)O)CC3c2ccc(Cl)c(Cl)c2)OC1(C)C |
| InChI | InChI=1S/C22H24BCl2NO4/c1-21(2)22(3,4)30-23(29-21)15-6-7-16-14(9-15)11-26(20(27)28)12-17(16)13-5-8-18(24)19(25)10-13/h5-10,17H,11-12H2,1-4H3,(H,27,28) |
| InChIKey | DSKFTULVBNXMAC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|