C22H25BCl2FNO2 — CID 66788241
4-(3,4-dichlorophenyl)-6-fluoro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 66788241) has the molecular formula C22H25BCl2FNO2 and a molecular weight of 436.16 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-6-fluoro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 4-(3,4-dichlorophenyl)-6-fluoro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 66788241 |
| Molecular Formula | C22H25BCl2FNO2 |
| Molecular Weight | 436.16 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-6-fluoro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2cc(B3OC(C)(C)C(C)(C)O3)c(F)cc2C(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C22H25BCl2FNO2/c1-21(2)22(3,4)29-23(28-21)17-8-14-11-27(5)12-16(15(14)10-20(17)26)13-6-7-18(24)19(25)9-13/h6-10,16H,11-12H2,1-5H3 |
| InChIKey | ILTFDXGJUAEBLC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.16 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|