C23H28Cl2N2O2 — CID 11561136
4-[3-[[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]morpholine (PubChem CID 11561136) has the molecular formula C23H28Cl2N2O2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 4-[3-[[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]morpholine.
| Compound Name | 4-[3-[[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]morpholine |
|---|---|
| PubChem CID | 11561136 |
| Molecular Formula | C23H28Cl2N2O2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 4-[3-[[4-(3,4-dichlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]propyl]morpholine |
| SMILES | CN1Cc2cc(OCCCN3CCOCC3)ccc2C(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H28Cl2N2O2/c1-26-15-18-13-19(29-10-2-7-27-8-11-28-12-9-27)4-5-20(18)21(16-26)17-3-6-22(24)23(25)14-17/h3-6,13-14,21H,2,7-12,15-16H2,1H3 |
| InChIKey | CDSJKEWHYRZXDI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|