C24H31N3O3 — CID 59383351
5-[(6R,10bS)-9-(3-morpholin-4-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-1H-pyridin-2-one (PubChem CID 59383351) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 5-[(6R,10bS)-9-(3-morpholin-4-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-1H-pyridin-2-one.
| Compound Name | 5-[(6R,10bS)-9-(3-morpholin-4-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 59383351 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 5-[(6R,10bS)-9-(3-morpholin-4-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-1H-pyridin-2-one |
| SMILES | O=c1ccc([C@@H]2CN3CCC[C@H]3c3cc(OCCCN4CCOCC4)ccc32)c[nH]1 |
| InChI | InChI=1S/C24H31N3O3/c28-24-7-4-18(16-25-24)22-17-27-9-1-3-23(27)21-15-19(5-6-20(21)22)30-12-2-8-26-10-13-29-14-11-26/h4-7,15-16,22-23H,1-3,8-14,17H2,(H,25,28)/t22-,23-/m0/s1 |
| InChIKey | NMZGECGKXWYORP-GOTSBHOMSA-N |
| XLogP | 2.76 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|