C28H32F6N2O — CID 57431073
6-[3,5-bis(trifluoromethyl)phenyl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 57431073) has the molecular formula C28H32F6N2O and a molecular weight of 526.57 g/mol. Its IUPAC name is 6-[3,5-bis(trifluoromethyl)phenyl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | 6-[3,5-bis(trifluoromethyl)phenyl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 57431073 |
| Molecular Formula | C28H32F6N2O |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 6-[3,5-bis(trifluoromethyl)phenyl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | FC(F)(F)c1cc(C2CN3CCCC3c3cc(OCCCN4CCCCC4)ccc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H32F6N2O/c29-27(30,31)20-14-19(15-21(16-20)28(32,33)34)25-18-36-12-4-6-26(36)24-17-22(7-8-23(24)25)37-13-5-11-35-9-2-1-3-10-35/h7-8,14-17,25-26H,1-6,9-13,18H2 |
| InChIKey | YNOSYFULZBXNJA-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|