C26H34N2O2 — CID 59383330
2-[(6S,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]phenol (PubChem CID 59383330) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[(6S,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]phenol.
| Compound Name | 2-[(6S,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]phenol |
|---|---|
| PubChem CID | 59383330 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-[(6S,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1CN2CCC[C@H]2c2cc(OCCCN3CCCCC3)ccc21 |
| InChI | InChI=1S/C26H34N2O2/c29-26-10-3-2-8-22(26)24-19-28-16-6-9-25(28)23-18-20(11-12-21(23)24)30-17-7-15-27-13-4-1-5-14-27/h2-3,8,10-12,18,24-25,29H,1,4-7,9,13-17,19H2/t24-,25-/m0/s1 |
| InChIKey | MWVCQJIYVWMESH-DQEYMECFSA-N |
| XLogP | 4.93 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|