C26H32N4O2 — CID 67543445
4-[3-[[(6S,10bS)-6-imidazo[1,2-a]pyridin-3-yl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine (PubChem CID 67543445) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 4-[3-[[(6S,10bS)-6-imidazo[1,2-a]pyridin-3-yl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine.
| Compound Name | 4-[3-[[(6S,10bS)-6-imidazo[1,2-a]pyridin-3-yl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine |
|---|---|
| PubChem CID | 67543445 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 4-[3-[[(6S,10bS)-6-imidazo[1,2-a]pyridin-3-yl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine |
| SMILES | c1ccn2c([C@@H]3CN4CCC[C@H]4c4cc(OCCCN5CCOCC5)ccc43)cnc2c1 |
| InChI | InChI=1S/C26H32N4O2/c1-2-11-30-25(18-27-26(30)6-1)23-19-29-10-3-5-24(29)22-17-20(7-8-21(22)23)32-14-4-9-28-12-15-31-16-13-28/h1-2,6-8,11,17-18,23-24H,3-5,9-10,12-16,19H2/t23-,24+/m1/s1 |
| InChIKey | ZQTMZQQRQHGNJG-RPWUZVMVSA-N |
| XLogP | 3.72 |
| TPSA | 42.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|