C26H31F3N2O2S — CID 67542875
4-[3-[[6-[4-(trifluoromethylsulfanyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine (PubChem CID 67542875) has the molecular formula C26H31F3N2O2S and a molecular weight of 492.61 g/mol. Its IUPAC name is 4-[3-[[6-[4-(trifluoromethylsulfanyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine.
| Compound Name | 4-[3-[[6-[4-(trifluoromethylsulfanyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine |
|---|---|
| PubChem CID | 67542875 |
| Molecular Formula | C26H31F3N2O2S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-[3-[[6-[4-(trifluoromethylsulfanyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine |
| SMILES | FC(F)(F)Sc1ccc(C2CN3CCCC3c3cc(OCCCN4CCOCC4)ccc32)cc1 |
| InChI | InChI=1S/C26H31F3N2O2S/c27-26(28,29)34-21-7-4-19(5-8-21)24-18-31-11-1-3-25(31)23-17-20(6-9-22(23)24)33-14-2-10-30-12-15-32-16-13-30/h4-9,17,24-25H,1-3,10-16,18H2 |
| InChIKey | GJMGSQYRHQQTFW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|