C22H29N3O2S — CID 67543228
4-[3-[[(6S,10bS)-6-(1,3-thiazol-5-yl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine (PubChem CID 67543228) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 4-[3-[[(6S,10bS)-6-(1,3-thiazol-5-yl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine.
| Compound Name | 4-[3-[[(6S,10bS)-6-(1,3-thiazol-5-yl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine |
|---|---|
| PubChem CID | 67543228 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[3-[[(6S,10bS)-6-(1,3-thiazol-5-yl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-9-yl]oxy]propyl]morpholine |
| SMILES | c1ncc([C@@H]2CN3CCC[C@H]3c3cc(OCCCN4CCOCC4)ccc32)s1 |
| InChI | InChI=1S/C22H29N3O2S/c1-3-21-19-13-17(27-10-2-6-24-8-11-26-12-9-24)4-5-18(19)20(15-25(21)7-1)22-14-23-16-28-22/h4-5,13-14,16,20-21H,1-3,6-12,15H2/t20-,21+/m1/s1 |
| InChIKey | VYEDDDWXKRDQRX-RTWAWAEBSA-N |
| XLogP | 3.53 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|