C27H33F3N2O — CID 59383343
(6R,10bS)-9-(3-piperidin-1-ylpropoxy)-6-[3-(trifluoromethyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 59383343) has the molecular formula C27H33F3N2O and a molecular weight of 458.57 g/mol. Its IUPAC name is (6R,10bS)-9-(3-piperidin-1-ylpropoxy)-6-[3-(trifluoromethyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | (6R,10bS)-9-(3-piperidin-1-ylpropoxy)-6-[3-(trifluoromethyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 59383343 |
| Molecular Formula | C27H33F3N2O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (6R,10bS)-9-(3-piperidin-1-ylpropoxy)-6-[3-(trifluoromethyl)phenyl]-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | FC(F)(F)c1cccc([C@H]2CN3CCC[C@H]3c3cc(OCCCN4CCCCC4)ccc32)c1 |
| InChI | InChI=1S/C27H33F3N2O/c28-27(29,30)21-8-4-7-20(17-21)25-19-32-15-5-9-26(32)24-18-22(10-11-23(24)25)33-16-6-14-31-12-2-1-3-13-31/h4,7-8,10-11,17-18,25-26H,1-3,5-6,9,12-16,19H2/t25-,26+/m1/s1 |
| InChIKey | VKNVUSIACZZCCO-FTJBHMTQSA-N |
| XLogP | 6.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|