C28H39N3O — CID 59383377
4-[(6R,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-N,N-dimethylaniline (PubChem CID 59383377) has the molecular formula C28H39N3O and a molecular weight of 433.64 g/mol. Its IUPAC name is 4-[(6R,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(6R,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59383377 |
| Molecular Formula | C28H39N3O |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | 4-[(6R,10bS)-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinolin-6-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@H]2CN3CCC[C@H]3c3cc(OCCCN4CCCCC4)ccc32)cc1 |
| InChI | InChI=1S/C28H39N3O/c1-29(2)23-11-9-22(10-12-23)27-21-31-18-6-8-28(31)26-20-24(13-14-25(26)27)32-19-7-17-30-15-4-3-5-16-30/h9-14,20,27-28H,3-8,15-19,21H2,1-2H3/t27-,28+/m1/s1 |
| InChIKey | XHVBANRDQDBXCL-IZLXSDGUSA-N |
| XLogP | 5.29 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|