C26H33F3N2O2 — CID 11669833
4-(4-methoxyphenyl)-2-methyl-7-[3-[3-(trifluoromethyl)piperidin-1-yl]propoxy]-3,4-dihydro-1H-isoquinoline (PubChem CID 11669833) has the molecular formula C26H33F3N2O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-methyl-7-[3-[3-(trifluoromethyl)piperidin-1-yl]propoxy]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 4-(4-methoxyphenyl)-2-methyl-7-[3-[3-(trifluoromethyl)piperidin-1-yl]propoxy]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11669833 |
| Molecular Formula | C26H33F3N2O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-methyl-7-[3-[3-(trifluoromethyl)piperidin-1-yl]propoxy]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(C2CN(C)Cc3cc(OCCCN4CCCC(C(F)(F)F)C4)ccc32)cc1 |
| InChI | InChI=1S/C26H33F3N2O2/c1-30-16-20-15-23(33-14-4-13-31-12-3-5-21(17-31)26(27,28)29)10-11-24(20)25(18-30)19-6-8-22(32-2)9-7-19/h6-11,15,21,25H,3-5,12-14,16-18H2,1-2H3 |
| InChIKey | AQWGMJIFSCZRLZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|